About methyl 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoate
methyl 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoate (PubChem CID 10293795) has the molecular formula C20H38O5S
and a molecular weight of 390.59 g/mol. Its IUPAC name is methyl 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoate.
Molecular Properties
| Compound Name | methyl 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoate |
| PubChem CID | 10293795 |
| Molecular Formula | C20H38O5S |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | methyl 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoate |
| SMILES | COC(=O)C(C)(C)CCCCCS(=O)CCCCCC(C)(C)C(=O)OC |
| InChI | InChI=1S/C20H38O5S/c1-19(2,17(21)24-5)13-9-7-11-15-26(23)16-12-8-10-14-20(3,4)18(22)25-6/h7-16H2,1-6H3 |
| InChIKey | JQAGTRCOXCMOCM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoate?
The IUPAC name of methyl 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoate (CID 10293795) is methyl 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoate.
What is the SMILES notation for methyl 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoate?
The canonical SMILES for methyl 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoate is COC(=O)C(C)(C)CCCCCS(=O)CCCCCC(C)(C)C(=O)OC.
What is the InChIKey of methyl 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoate?
The InChIKey is JQAGTRCOXCMOCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O5S/c1-19(2,17(21)24-5)13-9-7-11-15-26(23)16-12-8-10-14-20(3,4)18(22)25-6/h7-16H2,1-6H3.
What are the key properties of methyl 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoate?
methyl 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoate has a molecular weight of 390.59 g/mol, XLogP of 4.25, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoate is sourced from PubChem (CID 10293795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).