C14H18F2N2O3 — CID 102938275
[2-(aminomethyl)-6-methylmorpholin-4-yl]-[3-(difluoromethoxy)phenyl]methanone (PubChem CID 102938275) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.31 g/mol. Its IUPAC name is [2-(aminomethyl)-6-methylmorpholin-4-yl]-[3-(difluoromethoxy)phenyl]methanone.
| Compound Name | [2-(aminomethyl)-6-methylmorpholin-4-yl]-[3-(difluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 102938275 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | [2-(aminomethyl)-6-methylmorpholin-4-yl]-[3-(difluoromethoxy)phenyl]methanone |
| SMILES | CC1CN(C(=O)c2cccc(OC(F)F)c2)CC(CN)O1 |
| InChI | InChI=1S/C14H18F2N2O3/c1-9-7-18(8-12(6-17)20-9)13(19)10-3-2-4-11(5-10)21-14(15)16/h2-5,9,12,14H,6-8,17H2,1H3 |
| InChIKey | MWVXDQXXMDWEHV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |