C18H13FNO4S2- — CID 10293840
3-[3-fluoro-4-(sulfinatoamino)phenyl]-2-methoxycarbonyl-4-phenylthiophene (PubChem CID 10293840) has the molecular formula C18H13FNO4S2- and a molecular weight of 390.44 g/mol. Its IUPAC name is 3-[3-fluoro-4-(sulfinatoamino)phenyl]-2-methoxycarbonyl-4-phenylthiophene.
| Compound Name | 3-[3-fluoro-4-(sulfinatoamino)phenyl]-2-methoxycarbonyl-4-phenylthiophene |
|---|---|
| PubChem CID | 10293840 |
| Molecular Formula | C18H13FNO4S2- |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 3-[3-fluoro-4-(sulfinatoamino)phenyl]-2-methoxycarbonyl-4-phenylthiophene |
| SMILES | COC(=O)c1scc(-c2ccccc2)c1-c1ccc(NS(=O)[O-])c(F)c1 |
| InChI | InChI=1S/C18H14FNO4S2/c1-24-18(21)17-16(13(10-25-17)11-5-3-2-4-6-11)12-7-8-15(14(19)9-12)20-26(22)23/h2-10,20H,1H3,(H,22,23)/p-1 |
| InChIKey | MZZRNWRAGBPKNA-UHFFFAOYSA-M |
| XLogP | 4.21 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|