About ethyl N-[5-(2-methyl-4,5-diphenylimidazol-1-yl)pentyl]carbamate
ethyl N-[5-(2-methyl-4,5-diphenylimidazol-1-yl)pentyl]carbamate (PubChem CID 10293867) has the molecular formula C24H29N3O2
and a molecular weight of 391.52 g/mol. Its IUPAC name is ethyl N-[5-(2-methyl-4,5-diphenylimidazol-1-yl)pentyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[5-(2-methyl-4,5-diphenylimidazol-1-yl)pentyl]carbamate |
| PubChem CID | 10293867 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | ethyl N-[5-(2-methyl-4,5-diphenylimidazol-1-yl)pentyl]carbamate |
| SMILES | CCOC(=O)NCCCCCn1c(C)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H29N3O2/c1-3-29-24(28)25-17-11-6-12-18-27-19(2)26-22(20-13-7-4-8-14-20)23(27)21-15-9-5-10-16-21/h4-5,7-10,13-16H,3,6,11-12,17-18H2,1-2H3,(H,25,28) |
| InChIKey | VZSXUVQCPYUMAW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[5-(2-methyl-4,5-diphenylimidazol-1-yl)pentyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[5-(2-methyl-4,5-diphenylimidazol-1-yl)pentyl]carbamate?
The IUPAC name of ethyl N-[5-(2-methyl-4,5-diphenylimidazol-1-yl)pentyl]carbamate (CID 10293867) is ethyl N-[5-(2-methyl-4,5-diphenylimidazol-1-yl)pentyl]carbamate.
What is the SMILES notation for ethyl N-[5-(2-methyl-4,5-diphenylimidazol-1-yl)pentyl]carbamate?
The canonical SMILES for ethyl N-[5-(2-methyl-4,5-diphenylimidazol-1-yl)pentyl]carbamate is CCOC(=O)NCCCCCn1c(C)nc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of ethyl N-[5-(2-methyl-4,5-diphenylimidazol-1-yl)pentyl]carbamate?
The InChIKey is VZSXUVQCPYUMAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N3O2/c1-3-29-24(28)25-17-11-6-12-18-27-19(2)26-22(20-13-7-4-8-14-20)23(27)21-15-9-5-10-16-21/h4-5,7-10,13-16H,3,6,11-12,17-18H2,1-2H3,(H,25,28).
What are the key properties of ethyl N-[5-(2-methyl-4,5-diphenylimidazol-1-yl)pentyl]carbamate?
ethyl N-[5-(2-methyl-4,5-diphenylimidazol-1-yl)pentyl]carbamate has a molecular weight of 391.52 g/mol, XLogP of 5.44, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[5-(2-methyl-4,5-diphenylimidazol-1-yl)pentyl]carbamate is sourced from PubChem (CID 10293867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).