C25H35N3O — CID 10293998
3-benzyl-1-[(4-methylphenyl)methyl]-1-[1-(2-methylpropyl)piperidin-4-yl]urea (PubChem CID 10293998) has the molecular formula C25H35N3O and a molecular weight of 393.58 g/mol. Its IUPAC name is 3-benzyl-1-[(4-methylphenyl)methyl]-1-[1-(2-methylpropyl)piperidin-4-yl]urea.
| Compound Name | 3-benzyl-1-[(4-methylphenyl)methyl]-1-[1-(2-methylpropyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 10293998 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | 3-benzyl-1-[(4-methylphenyl)methyl]-1-[1-(2-methylpropyl)piperidin-4-yl]urea |
| SMILES | Cc1ccc(CN(C(=O)NCc2ccccc2)C2CCN(CC(C)C)CC2)cc1 |
| InChI | InChI=1S/C25H35N3O/c1-20(2)18-27-15-13-24(14-16-27)28(19-23-11-9-21(3)10-12-23)25(29)26-17-22-7-5-4-6-8-22/h4-12,20,24H,13-19H2,1-3H3,(H,26,29) |
| InChIKey | KAVWAIIIKBEBCY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |