C10H4F3NO2 — CID 102941779
5,6,8-trifluoroquinoline-4-carboxylic acid (PubChem CID 102941779) has the molecular formula C10H4F3NO2 and a molecular weight of 227.14 g/mol. Its IUPAC name is 5,6,8-trifluoroquinoline-4-carboxylic acid.
| Compound Name | 5,6,8-trifluoroquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 102941779 |
| Molecular Formula | C10H4F3NO2 |
| Molecular Weight | 227.14 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 5,6,8-trifluoroquinoline-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc2c(F)cc(F)c(F)c12 |
| InChI | InChI=1S/C10H4F3NO2/c11-5-3-6(12)9-7(8(5)13)4(10(15)16)1-2-14-9/h1-3H,(H,15,16) |
| InChIKey | IBPQHXQVOZDESW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.14 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|