C11H6F3NO3 — CID 102941991
6,7,8-trifluoro-4-methoxyquinoline-2-carboxylic acid (PubChem CID 102941991) has the molecular formula C11H6F3NO3 and a molecular weight of 257.17 g/mol. Its IUPAC name is 6,7,8-trifluoro-4-methoxyquinoline-2-carboxylic acid.
| Compound Name | 6,7,8-trifluoro-4-methoxyquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 102941991 |
| Molecular Formula | C11H6F3NO3 |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 6,7,8-trifluoro-4-methoxyquinoline-2-carboxylic acid |
| SMILES | COc1cc(C(=O)O)nc2c(F)c(F)c(F)cc12 |
| InChI | InChI=1S/C11H6F3NO3/c1-18-7-3-6(11(16)17)15-10-4(7)2-5(12)8(13)9(10)14/h2-3H,1H3,(H,16,17) |
| InChIKey | YZCHWSMLTZJSFS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|