C14H24ClN3O6S — CID 10294259
(2R,3R)-2,3-dihydroxybutanedioic acid;(6S)-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;hydrochloride (PubChem CID 10294259) has the molecular formula C14H24ClN3O6S and a molecular weight of 397.88 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioic acid;(6S)-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;hydrochloride.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioic acid;(6S)-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 10294259 |
| Molecular Formula | C14H24ClN3O6S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;(6S)-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;hydrochloride |
| SMILES | CCCN[C@H]1CCc2nc(N)sc2C1.Cl.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C10H17N3S.C4H6O6.ClH/c1-2-5-12-7-3-4-8-9(6-7)14-10(11)13-8;5-1(3(7)8)2(6)4(9)10;/h7,12H,2-6H2,1H3,(H2,11,13);1-2,5-6H,(H,7,8)(H,9,10);1H/t7-;1-,2-;/m01./s1 |
| InChIKey | XIJQZRXLNKDDNB-RADJLRAZSA-N |
| XLogP | -0.12 |
| TPSA | 166.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |