C18H24ClN3O3S — CID 10294264
1-chloro-3-[(1R)-2-[2-[4-(dimethylsulfamoylamino)phenyl]ethylamino]-1-hydroxyethyl]benzene (PubChem CID 10294264) has the molecular formula C18H24ClN3O3S and a molecular weight of 397.93 g/mol. Its IUPAC name is 1-chloro-3-[(1R)-2-[2-[4-(dimethylsulfamoylamino)phenyl]ethylamino]-1-hydroxyethyl]benzene.
| Compound Name | 1-chloro-3-[(1R)-2-[2-[4-(dimethylsulfamoylamino)phenyl]ethylamino]-1-hydroxyethyl]benzene |
|---|---|
| PubChem CID | 10294264 |
| Molecular Formula | C18H24ClN3O3S |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 1-chloro-3-[(1R)-2-[2-[4-(dimethylsulfamoylamino)phenyl]ethylamino]-1-hydroxyethyl]benzene |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(CCNC[C@H](O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H24ClN3O3S/c1-22(2)26(24,25)21-17-8-6-14(7-9-17)10-11-20-13-18(23)15-4-3-5-16(19)12-15/h3-9,12,18,20-21,23H,10-11,13H2,1-2H3/t18-/m0/s1 |
| InChIKey | UBXCXOLZLXDFSH-SFHVURJKSA-N |
| XLogP | 2.42 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|