About 1-(2-tert-butylphenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine
1-(2-tert-butylphenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine (PubChem CID 102942928) has the molecular formula C16H21N3O
and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-(2-tert-butylphenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine.
Molecular Properties
| Compound Name | 1-(2-tert-butylphenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine |
| PubChem CID | 102942928 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 1-(2-tert-butylphenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine |
| SMILES | CC(C)(C)c1ccccc1-n1nc(N)c2c1CCOC2 |
| InChI | InChI=1S/C16H21N3O/c1-16(2,3)12-6-4-5-7-14(12)19-13-8-9-20-10-11(13)15(17)18-19/h4-7H,8-10H2,1-3H3,(H2,17,18) |
| InChIKey | SWZWZGGTFPQEHT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-tert-butylphenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-tert-butylphenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine?
The IUPAC name of 1-(2-tert-butylphenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine (CID 102942928) is 1-(2-tert-butylphenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine.
What is the SMILES notation for 1-(2-tert-butylphenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine?
The canonical SMILES for 1-(2-tert-butylphenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine is CC(C)(C)c1ccccc1-n1nc(N)c2c1CCOC2.
What is the InChIKey of 1-(2-tert-butylphenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine?
The InChIKey is SWZWZGGTFPQEHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O/c1-16(2,3)12-6-4-5-7-14(12)19-13-8-9-20-10-11(13)15(17)18-19/h4-7H,8-10H2,1-3H3,(H2,17,18).
What are the key properties of 1-(2-tert-butylphenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine?
1-(2-tert-butylphenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine has a molecular weight of 271.36 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-tert-butylphenyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-3-amine is sourced from PubChem (CID 102942928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).