About 5-(6-bicyclo[3.1.0]hexanyl)-3-bromo-1,2,4-thiadiazole
5-(6-bicyclo[3.1.0]hexanyl)-3-bromo-1,2,4-thiadiazole (PubChem CID 102943214) has the molecular formula C8H9BrN2S
and a molecular weight of 245.14 g/mol. Its IUPAC name is 5-(6-bicyclo[3.1.0]hexanyl)-3-bromo-1,2,4-thiadiazole.
Analyze 5-(6-bicyclo[3.1.0]hexanyl)-3-bromo-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-bicyclo[3.1.0]hexanyl)-3-bromo-1,2,4-thiadiazole?
The IUPAC name of 5-(6-bicyclo[3.1.0]hexanyl)-3-bromo-1,2,4-thiadiazole (CID 102943214) is 5-(6-bicyclo[3.1.0]hexanyl)-3-bromo-1,2,4-thiadiazole.
What is the SMILES notation for 5-(6-bicyclo[3.1.0]hexanyl)-3-bromo-1,2,4-thiadiazole?
The canonical SMILES for 5-(6-bicyclo[3.1.0]hexanyl)-3-bromo-1,2,4-thiadiazole is Brc1nsc(C2C3CCCC32)n1.
What is the InChIKey of 5-(6-bicyclo[3.1.0]hexanyl)-3-bromo-1,2,4-thiadiazole?
The InChIKey is NLPDHHSWUBZLAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN2S/c9-8-10-7(12-11-8)6-4-2-1-3-5(4)6/h4-6H,1-3H2.
What are the key properties of 5-(6-bicyclo[3.1.0]hexanyl)-3-bromo-1,2,4-thiadiazole?
5-(6-bicyclo[3.1.0]hexanyl)-3-bromo-1,2,4-thiadiazole has a molecular weight of 245.14 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-bicyclo[3.1.0]hexanyl)-3-bromo-1,2,4-thiadiazole is sourced from PubChem (CID 102943214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).