C9H5F2IN2S — CID 102943566
5-[(2,3-difluorophenyl)methyl]-3-iodo-1,2,4-thiadiazole (PubChem CID 102943566) has the molecular formula C9H5F2IN2S and a molecular weight of 338.12 g/mol. Its IUPAC name is 5-[(2,3-difluorophenyl)methyl]-3-iodo-1,2,4-thiadiazole.
| Compound Name | 5-[(2,3-difluorophenyl)methyl]-3-iodo-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102943566 |
| Molecular Formula | C9H5F2IN2S |
| Molecular Weight | 338.12 g/mol |
| Exact Mass | 337.92 |
| IUPAC Name | 5-[(2,3-difluorophenyl)methyl]-3-iodo-1,2,4-thiadiazole |
| SMILES | Fc1cccc(Cc2nc(I)ns2)c1F |
| InChI | InChI=1S/C9H5F2IN2S/c10-6-3-1-2-5(8(6)11)4-7-13-9(12)14-15-7/h1-3H,4H2 |
| InChIKey | BQUHKRHSJRNRRU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.12 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|