C8H9ClF2N2S — CID 102944032
3-chloro-5-(4,4-difluorocyclohexyl)-1,2,4-thiadiazole (PubChem CID 102944032) has the molecular formula C8H9ClF2N2S and a molecular weight of 238.69 g/mol. Its IUPAC name is 3-chloro-5-(4,4-difluorocyclohexyl)-1,2,4-thiadiazole.
| Compound Name | 3-chloro-5-(4,4-difluorocyclohexyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102944032 |
| Molecular Formula | C8H9ClF2N2S |
| Molecular Weight | 238.69 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 3-chloro-5-(4,4-difluorocyclohexyl)-1,2,4-thiadiazole |
| SMILES | FC1(F)CCC(c2nc(Cl)ns2)CC1 |
| InChI | InChI=1S/C8H9ClF2N2S/c9-7-12-6(14-13-7)5-1-3-8(10,11)4-2-5/h5H,1-4H2 |
| InChIKey | OKNDLKJUBGIIQF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.69 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |