About 3-chloro-5-(5-methylpyrazin-2-yl)-1,2,4-thiadiazole
3-chloro-5-(5-methylpyrazin-2-yl)-1,2,4-thiadiazole (PubChem CID 102944047) has the molecular formula C7H5ClN4S
and a molecular weight of 212.67 g/mol. Its IUPAC name is 3-chloro-5-(5-methylpyrazin-2-yl)-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3-chloro-5-(5-methylpyrazin-2-yl)-1,2,4-thiadiazole |
| PubChem CID | 102944047 |
| Molecular Formula | C7H5ClN4S |
| Molecular Weight | 212.67 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 3-chloro-5-(5-methylpyrazin-2-yl)-1,2,4-thiadiazole |
| SMILES | Cc1cnc(-c2nc(Cl)ns2)cn1 |
| InChI | InChI=1S/C7H5ClN4S/c1-4-2-10-5(3-9-4)6-11-7(8)12-13-6/h2-3H,1H3 |
| InChIKey | QQAKYBKSHHRBPE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.67 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-5-(5-methylpyrazin-2-yl)-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-(5-methylpyrazin-2-yl)-1,2,4-thiadiazole?
The IUPAC name of 3-chloro-5-(5-methylpyrazin-2-yl)-1,2,4-thiadiazole (CID 102944047) is 3-chloro-5-(5-methylpyrazin-2-yl)-1,2,4-thiadiazole.
What is the SMILES notation for 3-chloro-5-(5-methylpyrazin-2-yl)-1,2,4-thiadiazole?
The canonical SMILES for 3-chloro-5-(5-methylpyrazin-2-yl)-1,2,4-thiadiazole is Cc1cnc(-c2nc(Cl)ns2)cn1.
What is the InChIKey of 3-chloro-5-(5-methylpyrazin-2-yl)-1,2,4-thiadiazole?
The InChIKey is QQAKYBKSHHRBPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN4S/c1-4-2-10-5(3-9-4)6-11-7(8)12-13-6/h2-3H,1H3.
What are the key properties of 3-chloro-5-(5-methylpyrazin-2-yl)-1,2,4-thiadiazole?
3-chloro-5-(5-methylpyrazin-2-yl)-1,2,4-thiadiazole has a molecular weight of 212.67 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-(5-methylpyrazin-2-yl)-1,2,4-thiadiazole is sourced from PubChem (CID 102944047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).