C14H15NO4 — CID 102944186
(2R,5S)-5-(2,3-dihydroindole-1-carbonyl)oxolane-2-carboxylic acid (PubChem CID 102944186) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is (2R,5S)-5-(2,3-dihydroindole-1-carbonyl)oxolane-2-carboxylic acid.
| Compound Name | (2R,5S)-5-(2,3-dihydroindole-1-carbonyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 102944186 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (2R,5S)-5-(2,3-dihydroindole-1-carbonyl)oxolane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC[C@@H](C(=O)N2CCc3ccccc32)O1 |
| InChI | InChI=1S/C14H15NO4/c16-13(11-5-6-12(19-11)14(17)18)15-8-7-9-3-1-2-4-10(9)15/h1-4,11-12H,5-8H2,(H,17,18)/t11-,12+/m0/s1 |
| InChIKey | PNXJVVGCEFKCJV-NWDGAFQWSA-N |
| XLogP | 1.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |