C18H12F6N2O2 — CID 10294500
2-[4-(5-amino-3-phenyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 10294500) has the molecular formula C18H12F6N2O2 and a molecular weight of 402.29 g/mol. Its IUPAC name is 2-[4-(5-amino-3-phenyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-(5-amino-3-phenyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 10294500 |
| Molecular Formula | C18H12F6N2O2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 2-[4-(5-amino-3-phenyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1onc(-c2ccccc2)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H12F6N2O2/c19-17(20,21)16(27,18(22,23)24)12-8-6-10(7-9-12)13-14(26-28-15(13)25)11-4-2-1-3-5-11/h1-9,27H,25H2 |
| InChIKey | SBWPCNXQABKKDU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |