C11H16F3NO4 — CID 102945549
(2R,5S)-5-(5,5,5-trifluoropentylcarbamoyl)oxolane-2-carboxylic acid (PubChem CID 102945549) has the molecular formula C11H16F3NO4 and a molecular weight of 283.25 g/mol. Its IUPAC name is (2R,5S)-5-(5,5,5-trifluoropentylcarbamoyl)oxolane-2-carboxylic acid.
| Compound Name | (2R,5S)-5-(5,5,5-trifluoropentylcarbamoyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 102945549 |
| Molecular Formula | C11H16F3NO4 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (2R,5S)-5-(5,5,5-trifluoropentylcarbamoyl)oxolane-2-carboxylic acid |
| SMILES | O=C(NCCCCC(F)(F)F)[C@@H]1CC[C@H](C(=O)O)O1 |
| InChI | InChI=1S/C11H16F3NO4/c12-11(13,14)5-1-2-6-15-9(16)7-3-4-8(19-7)10(17)18/h7-8H,1-6H2,(H,15,16)(H,17,18)/t7-,8+/m0/s1 |
| InChIKey | YCJYIQVTDUDENB-JGVFFNPUSA-N |
| XLogP | 1.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|