C16H14BrFN2O — CID 102946583
4-[[2-[(1R)-1-aminoethyl]-5-bromophenoxy]methyl]-3-fluorobenzonitrile (PubChem CID 102946583) has the molecular formula C16H14BrFN2O and a molecular weight of 349.20 g/mol. Its IUPAC name is 4-[[2-[(1R)-1-aminoethyl]-5-bromophenoxy]methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[[2-[(1R)-1-aminoethyl]-5-bromophenoxy]methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 102946583 |
| Molecular Formula | C16H14BrFN2O |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 4-[[2-[(1R)-1-aminoethyl]-5-bromophenoxy]methyl]-3-fluorobenzonitrile |
| SMILES | C[C@@H](N)c1ccc(Br)cc1OCc1ccc(C#N)cc1F |
| InChI | InChI=1S/C16H14BrFN2O/c1-10(20)14-5-4-13(17)7-16(14)21-9-12-3-2-11(8-19)6-15(12)18/h2-7,10H,9,20H2,1H3/t10-/m1/s1 |
| InChIKey | YBCOWLRIZFCELT-SNVBAGLBSA-N |
| XLogP | 4.06 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |