C14H18BrN3O2 — CID 102947684
2-[5-bromo-2-[1-(ethylamino)ethyl]phenoxy]-N-(cyanomethyl)acetamide (PubChem CID 102947684) has the molecular formula C14H18BrN3O2 and a molecular weight of 340.22 g/mol. Its IUPAC name is 2-[5-bromo-2-[1-(ethylamino)ethyl]phenoxy]-N-(cyanomethyl)acetamide.
| Compound Name | 2-[5-bromo-2-[1-(ethylamino)ethyl]phenoxy]-N-(cyanomethyl)acetamide |
|---|---|
| PubChem CID | 102947684 |
| Molecular Formula | C14H18BrN3O2 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 2-[5-bromo-2-[1-(ethylamino)ethyl]phenoxy]-N-(cyanomethyl)acetamide |
| SMILES | CCNC(C)c1ccc(Br)cc1OCC(=O)NCC#N |
| InChI | InChI=1S/C14H18BrN3O2/c1-3-17-10(2)12-5-4-11(15)8-13(12)20-9-14(19)18-7-6-16/h4-5,8,10,17H,3,7,9H2,1-2H3,(H,18,19) |
| InChIKey | MWOAYHUSKICASB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|