About 6-chloro-N-(3,4-dichlorophenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide
6-chloro-N-(3,4-dichlorophenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide (PubChem CID 10294845) has the molecular formula C18H13Cl3N4O
and a molecular weight of 407.69 g/mol. Its IUPAC name is 6-chloro-N-(3,4-dichlorophenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-chloro-N-(3,4-dichlorophenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
| PubChem CID | 10294845 |
| Molecular Formula | C18H13Cl3N4O |
| Molecular Weight | 407.69 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 6-chloro-N-(3,4-dichlorophenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1ccc(Cl)nc1NCc1ccncc1 |
| InChI | InChI=1S/C18H13Cl3N4O/c19-14-3-1-12(9-15(14)20)24-18(26)13-2-4-16(21)25-17(13)23-10-11-5-7-22-8-6-11/h1-9H,10H2,(H,23,25)(H,24,26) |
| InChIKey | RGMHIWWBTDCTFP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.69 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-(3,4-dichlorophenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(3,4-dichlorophenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide?
The IUPAC name of 6-chloro-N-(3,4-dichlorophenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide (CID 10294845) is 6-chloro-N-(3,4-dichlorophenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide.
What is the SMILES notation for 6-chloro-N-(3,4-dichlorophenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide?
The canonical SMILES for 6-chloro-N-(3,4-dichlorophenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide is O=C(Nc1ccc(Cl)c(Cl)c1)c1ccc(Cl)nc1NCc1ccncc1.
What is the InChIKey of 6-chloro-N-(3,4-dichlorophenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide?
The InChIKey is RGMHIWWBTDCTFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl3N4O/c19-14-3-1-12(9-15(14)20)24-18(26)13-2-4-16(21)25-17(13)23-10-11-5-7-22-8-6-11/h1-9H,10H2,(H,23,25)(H,24,26).
What are the key properties of 6-chloro-N-(3,4-dichlorophenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide?
6-chloro-N-(3,4-dichlorophenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide has a molecular weight of 407.69 g/mol, XLogP of 5.30, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(3,4-dichlorophenyl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide is sourced from PubChem (CID 10294845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).