C22H18ClN3O3 — CID 10294847
[1-(chloromethyl)-5-hydroxy-1,2-dihydropyrrolo[3,2-f]quinolin-3-yl]-(5-methoxy-1H-indol-2-yl)methanone (PubChem CID 10294847) has the molecular formula C22H18ClN3O3 and a molecular weight of 407.86 g/mol. Its IUPAC name is [1-(chloromethyl)-5-hydroxy-1,2-dihydropyrrolo[3,2-f]quinolin-3-yl]-(5-methoxy-1H-indol-2-yl)methanone.
| Compound Name | [1-(chloromethyl)-5-hydroxy-1,2-dihydropyrrolo[3,2-f]quinolin-3-yl]-(5-methoxy-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 10294847 |
| Molecular Formula | C22H18ClN3O3 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | [1-(chloromethyl)-5-hydroxy-1,2-dihydropyrrolo[3,2-f]quinolin-3-yl]-(5-methoxy-1H-indol-2-yl)methanone |
| SMILES | COc1ccc2[nH]c(C(=O)N3CC(CCl)c4c3cc(O)c3ncccc43)cc2c1 |
| InChI | InChI=1S/C22H18ClN3O3/c1-29-14-4-5-16-12(7-14)8-17(25-16)22(28)26-11-13(10-23)20-15-3-2-6-24-21(15)19(27)9-18(20)26/h2-9,13,25,27H,10-11H2,1H3 |
| InChIKey | PPPICDYIRPULJH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|