C17H30O7P2 — CID 10294864
[(2Z,6E)-7,11-dimethyl-3-prop-2-enyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate (PubChem CID 10294864) has the molecular formula C17H30O7P2 and a molecular weight of 408.37 g/mol. Its IUPAC name is [(2Z,6E)-7,11-dimethyl-3-prop-2-enyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate.
| Compound Name | [(2Z,6E)-7,11-dimethyl-3-prop-2-enyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10294864 |
| Molecular Formula | C17H30O7P2 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | [(2Z,6E)-7,11-dimethyl-3-prop-2-enyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate |
| SMILES | C=CC/C(=C\COP(=O)(O)OP(=O)(O)O)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C17H30O7P2/c1-5-8-17(12-7-11-16(4)10-6-9-15(2)3)13-14-23-26(21,22)24-25(18,19)20/h5,9,11,13H,1,6-8,10,12,14H2,2-4H3,(H,21,22)(H2,18,19,20)/b16-11+,17-13+ |
| InChIKey | PZTKNWVDWLMZOI-IUBLYSDUSA-N |
| XLogP | 5.19 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|