C26H35NO3 — CID 10294971
4-[2-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)heptoxy]benzoic acid (PubChem CID 10294971) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is 4-[2-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)heptoxy]benzoic acid.
| Compound Name | 4-[2-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)heptoxy]benzoic acid |
|---|---|
| PubChem CID | 10294971 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 4-[2-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)heptoxy]benzoic acid |
| SMILES | CCCCCC(COc1ccc(C(=O)O)cc1)c1ccc2c(c1)N(C)CCC2(C)C |
| InChI | InChI=1S/C26H35NO3/c1-5-6-7-8-21(18-30-22-12-9-19(10-13-22)25(28)29)20-11-14-23-24(17-20)27(4)16-15-26(23,2)3/h9-14,17,21H,5-8,15-16,18H2,1-4H3,(H,28,29) |
| InChIKey | CPEAOIDQOQSMJM-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|