About thioxanthen-9-one
thioxanthen-9-one (PubChem CID 10295) has the molecular formula C13H8OS
and a molecular weight of 212.27 g/mol. Its IUPAC name is thioxanthen-9-one.
Molecular Properties
| Compound Name | thioxanthen-9-one |
| PubChem CID | 10295 |
| Molecular Formula | C13H8OS |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | thioxanthen-9-one |
| SMILES | O=c1c2ccccc2sc2ccccc12 |
| InChI | InChI=1S/C13H8OS/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H |
| InChIKey | YRHRIQCWCFGUEQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze thioxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thioxanthen-9-one?
The IUPAC name of thioxanthen-9-one (CID 10295) is thioxanthen-9-one.
What is the SMILES notation for thioxanthen-9-one?
The canonical SMILES for thioxanthen-9-one is O=c1c2ccccc2sc2ccccc12.
What is the InChIKey of thioxanthen-9-one?
The InChIKey is YRHRIQCWCFGUEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8OS/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H.
What are the key properties of thioxanthen-9-one?
thioxanthen-9-one has a molecular weight of 212.27 g/mol, XLogP of 3.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thioxanthen-9-one is sourced from PubChem (CID 10295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).