C17H16F6N2O3 — CID 10295000
[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1H-imidazol-5-yl]methyl 2-methylpropanoate (PubChem CID 10295000) has the molecular formula C17H16F6N2O3 and a molecular weight of 410.31 g/mol. Its IUPAC name is [2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1H-imidazol-5-yl]methyl 2-methylpropanoate.
| Compound Name | [2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1H-imidazol-5-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 10295000 |
| Molecular Formula | C17H16F6N2O3 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1H-imidazol-5-yl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCc1cnc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)[nH]1 |
| InChI | InChI=1S/C17H16F6N2O3/c1-9(2)14(26)28-8-12-7-24-13(25-12)10-3-5-11(6-4-10)15(27,16(18,19)20)17(21,22)23/h3-7,9,27H,8H2,1-2H3,(H,24,25) |
| InChIKey | HKXMGTFZEDRXKH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |