C11H11BrN2O2S — CID 102950413
2-(3-bromothiophen-2-yl)-1-(6-methoxypyrimidin-4-yl)ethanol (PubChem CID 102950413) has the molecular formula C11H11BrN2O2S and a molecular weight of 315.19 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-1-(6-methoxypyrimidin-4-yl)ethanol.
| Compound Name | 2-(3-bromothiophen-2-yl)-1-(6-methoxypyrimidin-4-yl)ethanol |
|---|---|
| PubChem CID | 102950413 |
| Molecular Formula | C11H11BrN2O2S |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-1-(6-methoxypyrimidin-4-yl)ethanol |
| SMILES | COc1cc(C(O)Cc2sccc2Br)ncn1 |
| InChI | InChI=1S/C11H11BrN2O2S/c1-16-11-4-8(13-6-14-11)9(15)5-10-7(12)2-3-17-10/h2-4,6,9,15H,5H2,1H3 |
| InChIKey | UBZISAGPMNNJRL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |