C15H17BrFN3O — CID 102951934
2-(2-bromo-5-fluorophenyl)-N-ethyl-1-(6-methoxypyrimidin-4-yl)ethanamine (PubChem CID 102951934) has the molecular formula C15H17BrFN3O and a molecular weight of 354.22 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-N-ethyl-1-(6-methoxypyrimidin-4-yl)ethanamine.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-N-ethyl-1-(6-methoxypyrimidin-4-yl)ethanamine |
|---|---|
| PubChem CID | 102951934 |
| Molecular Formula | C15H17BrFN3O |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-N-ethyl-1-(6-methoxypyrimidin-4-yl)ethanamine |
| SMILES | CCNC(Cc1cc(F)ccc1Br)c1cc(OC)ncn1 |
| InChI | InChI=1S/C15H17BrFN3O/c1-3-18-13(14-8-15(21-2)20-9-19-14)7-10-6-11(17)4-5-12(10)16/h4-6,8-9,13,18H,3,7H2,1-2H3 |
| InChIKey | LGXFRPCJYMPPGS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |