About 4-[2-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]ethoxy]-1H-indole
4-[2-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]ethoxy]-1H-indole (PubChem CID 10295207) has the molecular formula C23H22Cl2N2O
and a molecular weight of 413.35 g/mol. Its IUPAC name is 4-[2-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]ethoxy]-1H-indole.
Molecular Properties
| Compound Name | 4-[2-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]ethoxy]-1H-indole |
| PubChem CID | 10295207 |
| Molecular Formula | C23H22Cl2N2O |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 4-[2-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]ethoxy]-1H-indole |
| SMILES | Clc1ccc(C2=CC3CCC(C2)N3CCOc2cccc3[nH]ccc23)cc1Cl |
| InChI | InChI=1S/C23H22Cl2N2O/c24-20-7-4-15(14-21(20)25)16-12-17-5-6-18(13-16)27(17)10-11-28-23-3-1-2-22-19(23)8-9-26-22/h1-4,7-9,12,14,17-18,26H,5-6,10-11,13H2 |
| InChIKey | VQOZKEVLIXCLAX-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[2-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]ethoxy]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]ethoxy]-1H-indole?
The IUPAC name of 4-[2-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]ethoxy]-1H-indole (CID 10295207) is 4-[2-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]ethoxy]-1H-indole.
What is the SMILES notation for 4-[2-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]ethoxy]-1H-indole?
The canonical SMILES for 4-[2-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]ethoxy]-1H-indole is Clc1ccc(C2=CC3CCC(C2)N3CCOc2cccc3[nH]ccc23)cc1Cl.
What is the InChIKey of 4-[2-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]ethoxy]-1H-indole?
The InChIKey is VQOZKEVLIXCLAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22Cl2N2O/c24-20-7-4-15(14-21(20)25)16-12-17-5-6-18(13-16)27(17)10-11-28-23-3-1-2-22-19(23)8-9-26-22/h1-4,7-9,12,14,17-18,26H,5-6,10-11,13H2.
What are the key properties of 4-[2-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]ethoxy]-1H-indole?
4-[2-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]ethoxy]-1H-indole has a molecular weight of 413.35 g/mol, XLogP of 6.17, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]ethoxy]-1H-indole is sourced from PubChem (CID 10295207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).