C21H31BN4O4 — CID 10295258
(6S)-3-amino-4-oxo-N-[(1R)-1-[(2R,6S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxamide (PubChem CID 10295258) has the molecular formula C21H31BN4O4 and a molecular weight of 414.32 g/mol. Its IUPAC name is (6S)-3-amino-4-oxo-N-[(1R)-1-[(2R,6S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxamide.
| Compound Name | (6S)-3-amino-4-oxo-N-[(1R)-1-[(2R,6S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 10295258 |
| Molecular Formula | C21H31BN4O4 |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (6S)-3-amino-4-oxo-N-[(1R)-1-[(2R,6S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxamide |
| SMILES | CC[C@H](NC(=O)[C@@H]1CCc2ncc(N)c(=O)n21)B1O[C@@H]2C3CC(C[C@]2(C)O1)C3(C)C |
| InChI | InChI=1S/C21H31BN4O4/c1-5-15(22-29-17-12-8-11(20(12,2)3)9-21(17,4)30-22)25-18(27)14-6-7-16-24-10-13(23)19(28)26(14)16/h10-12,14-15,17H,5-9,23H2,1-4H3,(H,25,27)/t11?,12?,14-,15-,17+,21-/m0/s1 |
| InChIKey | SCKZWTVCAREYRV-UHYVKUOISA-N |
| XLogP | 1.48 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|