C9H13ClN2OS — CID 102954585
4-chloro-2-(4-methylpiperidin-3-yl)oxy-1,3-thiazole (PubChem CID 102954585) has the molecular formula C9H13ClN2OS and a molecular weight of 232.74 g/mol. Its IUPAC name is 4-chloro-2-(4-methylpiperidin-3-yl)oxy-1,3-thiazole.
| Compound Name | 4-chloro-2-(4-methylpiperidin-3-yl)oxy-1,3-thiazole |
|---|---|
| PubChem CID | 102954585 |
| Molecular Formula | C9H13ClN2OS |
| Molecular Weight | 232.74 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 4-chloro-2-(4-methylpiperidin-3-yl)oxy-1,3-thiazole |
| SMILES | CC1CCNCC1Oc1nc(Cl)cs1 |
| InChI | InChI=1S/C9H13ClN2OS/c1-6-2-3-11-4-7(6)13-9-12-8(10)5-14-9/h5-7,11H,2-4H2,1H3 |
| InChIKey | IQYJMBRAXRTJNV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.74 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |