C20H19F6NO2 — CID 10295554
1,1,1,3,3,3-hexafluoro-2-[4-[(Z)-N-phenylmethoxy-C-propylcarbonimidoyl]phenyl]propan-2-ol (PubChem CID 10295554) has the molecular formula C20H19F6NO2 and a molecular weight of 419.37 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[(Z)-N-phenylmethoxy-C-propylcarbonimidoyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(Z)-N-phenylmethoxy-C-propylcarbonimidoyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 10295554 |
| Molecular Formula | C20H19F6NO2 |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(Z)-N-phenylmethoxy-C-propylcarbonimidoyl]phenyl]propan-2-ol |
| SMILES | CCC/C(=N/OCc1ccccc1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F6NO2/c1-2-6-17(27-29-13-14-7-4-3-5-8-14)15-9-11-16(12-10-15)18(28,19(21,22)23)20(24,25)26/h3-5,7-12,28H,2,6,13H2,1H3/b27-17- |
| InChIKey | PHRZIHYBHJCTIR-PKAZHMFMSA-N |
| XLogP | 5.72 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|