C12H19N3O3S — CID 102955753
5-amino-2-(3-methoxypiperidin-1-yl)benzenesulfonamide (PubChem CID 102955753) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 5-amino-2-(3-methoxypiperidin-1-yl)benzenesulfonamide.
| Compound Name | 5-amino-2-(3-methoxypiperidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 102955753 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 5-amino-2-(3-methoxypiperidin-1-yl)benzenesulfonamide |
| SMILES | COC1CCCN(c2ccc(N)cc2S(N)(=O)=O)C1 |
| InChI | InChI=1S/C12H19N3O3S/c1-18-10-3-2-6-15(8-10)11-5-4-9(13)7-12(11)19(14,16)17/h4-5,7,10H,2-3,6,8,13H2,1H3,(H2,14,16,17) |
| InChIKey | XSBUPMLTCKFFDC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|