C11H20N4O — CID 102955985
1-[2-(3-aminopyrazol-1-yl)ethyl]-4-methylpiperidin-3-ol (PubChem CID 102955985) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 1-[2-(3-aminopyrazol-1-yl)ethyl]-4-methylpiperidin-3-ol.
| Compound Name | 1-[2-(3-aminopyrazol-1-yl)ethyl]-4-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 102955985 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 1-[2-(3-aminopyrazol-1-yl)ethyl]-4-methylpiperidin-3-ol |
| SMILES | CC1CCN(CCn2ccc(N)n2)CC1O |
| InChI | InChI=1S/C11H20N4O/c1-9-2-4-14(8-10(9)16)6-7-15-5-3-11(12)13-15/h3,5,9-10,16H,2,4,6-8H2,1H3,(H2,12,13) |
| InChIKey | AEKIXXBCURTDKM-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |