C24H18F3N3O — CID 10295708
6-(4-phenylphenoxy)-N-[[2-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine (PubChem CID 10295708) has the molecular formula C24H18F3N3O and a molecular weight of 421.42 g/mol. Its IUPAC name is 6-(4-phenylphenoxy)-N-[[2-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine.
| Compound Name | 6-(4-phenylphenoxy)-N-[[2-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 10295708 |
| Molecular Formula | C24H18F3N3O |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 6-(4-phenylphenoxy)-N-[[2-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine |
| SMILES | FC(F)(F)c1ccccc1CNc1cc(Oc2ccc(-c3ccccc3)cc2)ncn1 |
| InChI | InChI=1S/C24H18F3N3O/c25-24(26,27)21-9-5-4-8-19(21)15-28-22-14-23(30-16-29-22)31-20-12-10-18(11-13-20)17-6-2-1-3-7-17/h1-14,16H,15H2,(H,28,29,30) |
| InChIKey | ZSEGABZWQBYMOO-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |