C14H22F3NO2 — CID 102958800
(3-hydroxy-4-methylpiperidin-1-yl)-[4-(trifluoromethyl)cyclohexyl]methanone (PubChem CID 102958800) has the molecular formula C14H22F3NO2 and a molecular weight of 293.33 g/mol. Its IUPAC name is (3-hydroxy-4-methylpiperidin-1-yl)-[4-(trifluoromethyl)cyclohexyl]methanone.
| Compound Name | (3-hydroxy-4-methylpiperidin-1-yl)-[4-(trifluoromethyl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 102958800 |
| Molecular Formula | C14H22F3NO2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (3-hydroxy-4-methylpiperidin-1-yl)-[4-(trifluoromethyl)cyclohexyl]methanone |
| SMILES | CC1CCN(C(=O)C2CCC(C(F)(F)F)CC2)CC1O |
| InChI | InChI=1S/C14H22F3NO2/c1-9-6-7-18(8-12(9)19)13(20)10-2-4-11(5-3-10)14(15,16)17/h9-12,19H,2-8H2,1H3 |
| InChIKey | BWZVPIVCZUOATH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |