C13H18Cl2N2O — CID 102959993
1-[(2,4-dichloro-6-methyl-3-pyridinyl)methyl]-4-methylpiperidin-3-ol (PubChem CID 102959993) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is 1-[(2,4-dichloro-6-methyl-3-pyridinyl)methyl]-4-methylpiperidin-3-ol.
| Compound Name | 1-[(2,4-dichloro-6-methyl-3-pyridinyl)methyl]-4-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 102959993 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-[(2,4-dichloro-6-methyl-3-pyridinyl)methyl]-4-methylpiperidin-3-ol |
| SMILES | Cc1cc(Cl)c(CN2CCC(C)C(O)C2)c(Cl)n1 |
| InChI | InChI=1S/C13H18Cl2N2O/c1-8-3-4-17(7-12(8)18)6-10-11(14)5-9(2)16-13(10)15/h5,8,12,18H,3-4,6-7H2,1-2H3 |
| InChIKey | FHAHXXPWKPXEKV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|