About 4-[3-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]propoxy]-1H-indole
4-[3-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]propoxy]-1H-indole (PubChem CID 10296101) has the molecular formula C24H24Cl2N2O
and a molecular weight of 427.38 g/mol. Its IUPAC name is 4-[3-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]propoxy]-1H-indole.
Molecular Properties
| Compound Name | 4-[3-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]propoxy]-1H-indole |
| PubChem CID | 10296101 |
| Molecular Formula | C24H24Cl2N2O |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 4-[3-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]propoxy]-1H-indole |
| SMILES | Clc1ccc(C2=CC3CCC(C2)N3CCCOc2cccc3[nH]ccc23)cc1Cl |
| InChI | InChI=1S/C24H24Cl2N2O/c25-21-8-5-16(15-22(21)26)17-13-18-6-7-19(14-17)28(18)11-2-12-29-24-4-1-3-23-20(24)9-10-27-23/h1,3-5,8-10,13,15,18-19,27H,2,6-7,11-12,14H2 |
| InChIKey | WCYNKWZHPZSXCS-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]propoxy]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]propoxy]-1H-indole?
The IUPAC name of 4-[3-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]propoxy]-1H-indole (CID 10296101) is 4-[3-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]propoxy]-1H-indole.
What is the SMILES notation for 4-[3-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]propoxy]-1H-indole?
The canonical SMILES for 4-[3-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]propoxy]-1H-indole is Clc1ccc(C2=CC3CCC(C2)N3CCCOc2cccc3[nH]ccc23)cc1Cl.
What is the InChIKey of 4-[3-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]propoxy]-1H-indole?
The InChIKey is WCYNKWZHPZSXCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24Cl2N2O/c25-21-8-5-16(15-22(21)26)17-13-18-6-7-19(14-17)28(18)11-2-12-29-24-4-1-3-23-20(24)9-10-27-23/h1,3-5,8-10,13,15,18-19,27H,2,6-7,11-12,14H2.
What are the key properties of 4-[3-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]propoxy]-1H-indole?
4-[3-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]propoxy]-1H-indole has a molecular weight of 427.38 g/mol, XLogP of 6.56, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]oct-2-en-8-yl]propoxy]-1H-indole is sourced from PubChem (CID 10296101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).