About 1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-4-methylpiperidin-3-ol
1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-4-methylpiperidin-3-ol (PubChem CID 102961085) has the molecular formula C15H28N4O
and a molecular weight of 280.42 g/mol. Its IUPAC name is 1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-4-methylpiperidin-3-ol.
Molecular Properties
| Compound Name | 1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-4-methylpiperidin-3-ol |
| PubChem CID | 102961085 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-4-methylpiperidin-3-ol |
| SMILES | CCCNCc1c(C)nn(C)c1N1CCC(C)C(O)C1 |
| InChI | InChI=1S/C15H28N4O/c1-5-7-16-9-13-12(3)17-18(4)15(13)19-8-6-11(2)14(20)10-19/h11,14,16,20H,5-10H2,1-4H3 |
| InChIKey | LKRDZBXXAQHNOD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-4-methylpiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-4-methylpiperidin-3-ol?
The IUPAC name of 1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-4-methylpiperidin-3-ol (CID 102961085) is 1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-4-methylpiperidin-3-ol.
What is the SMILES notation for 1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-4-methylpiperidin-3-ol?
The canonical SMILES for 1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-4-methylpiperidin-3-ol is CCCNCc1c(C)nn(C)c1N1CCC(C)C(O)C1.
What is the InChIKey of 1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-4-methylpiperidin-3-ol?
The InChIKey is LKRDZBXXAQHNOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N4O/c1-5-7-16-9-13-12(3)17-18(4)15(13)19-8-6-11(2)14(20)10-19/h11,14,16,20H,5-10H2,1-4H3.
What are the key properties of 1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-4-methylpiperidin-3-ol?
1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-4-methylpiperidin-3-ol has a molecular weight of 280.42 g/mol, XLogP of 1.44, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-4-methylpiperidin-3-ol is sourced from PubChem (CID 102961085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).