C14H24ClNO — CID 102961315
(3-chloro-4-methylpiperidin-1-yl)-(2,2,3,3-tetramethylcyclopropyl)methanone (PubChem CID 102961315) has the molecular formula C14H24ClNO and a molecular weight of 257.80 g/mol. Its IUPAC name is (3-chloro-4-methylpiperidin-1-yl)-(2,2,3,3-tetramethylcyclopropyl)methanone.
| Compound Name | (3-chloro-4-methylpiperidin-1-yl)-(2,2,3,3-tetramethylcyclopropyl)methanone |
|---|---|
| PubChem CID | 102961315 |
| Molecular Formula | C14H24ClNO |
| Molecular Weight | 257.80 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | (3-chloro-4-methylpiperidin-1-yl)-(2,2,3,3-tetramethylcyclopropyl)methanone |
| SMILES | CC1CCN(C(=O)C2C(C)(C)C2(C)C)CC1Cl |
| InChI | InChI=1S/C14H24ClNO/c1-9-6-7-16(8-10(9)15)12(17)11-13(2,3)14(11,4)5/h9-11H,6-8H2,1-5H3 |
| InChIKey | LWLCLVPTIJXUGP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.80 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|