C14H20ClNOS — CID 102961373
1-(3-chloro-4-methylpiperidin-1-yl)-4-thiophen-2-ylbutan-1-one (PubChem CID 102961373) has the molecular formula C14H20ClNOS and a molecular weight of 285.84 g/mol. Its IUPAC name is 1-(3-chloro-4-methylpiperidin-1-yl)-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-(3-chloro-4-methylpiperidin-1-yl)-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 102961373 |
| Molecular Formula | C14H20ClNOS |
| Molecular Weight | 285.84 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-(3-chloro-4-methylpiperidin-1-yl)-4-thiophen-2-ylbutan-1-one |
| SMILES | CC1CCN(C(=O)CCCc2cccs2)CC1Cl |
| InChI | InChI=1S/C14H20ClNOS/c1-11-7-8-16(10-13(11)15)14(17)6-2-4-12-5-3-9-18-12/h3,5,9,11,13H,2,4,6-8,10H2,1H3 |
| InChIKey | AGEBNRCYPXTKFE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.84 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|