About naphthalen-1-ylmethyl N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]carbamate
naphthalen-1-ylmethyl N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]carbamate (PubChem CID 10296143) has the molecular formula C23H29N3O3S
and a molecular weight of 427.57 g/mol. Its IUPAC name is naphthalen-1-ylmethyl N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]carbamate.
Molecular Properties
| Compound Name | naphthalen-1-ylmethyl N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]carbamate |
| PubChem CID | 10296143 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | naphthalen-1-ylmethyl N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]carbamate |
| SMILES | NC(C(=O)N1CCSC1)C1CCC(NC(=O)OCc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C23H29N3O3S/c24-21(22(27)26-12-13-30-15-26)17-8-10-19(11-9-17)25-23(28)29-14-18-6-3-5-16-4-1-2-7-20(16)18/h1-7,17,19,21H,8-15,24H2,(H,25,28) |
| InChIKey | KPULQFRFEHKYJN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze naphthalen-1-ylmethyl N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ylmethyl N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]carbamate?
The IUPAC name of naphthalen-1-ylmethyl N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]carbamate (CID 10296143) is naphthalen-1-ylmethyl N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]carbamate.
What is the SMILES notation for naphthalen-1-ylmethyl N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]carbamate?
The canonical SMILES for naphthalen-1-ylmethyl N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]carbamate is NC(C(=O)N1CCSC1)C1CCC(NC(=O)OCc2cccc3ccccc23)CC1.
What is the InChIKey of naphthalen-1-ylmethyl N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]carbamate?
The InChIKey is KPULQFRFEHKYJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29N3O3S/c24-21(22(27)26-12-13-30-15-26)17-8-10-19(11-9-17)25-23(28)29-14-18-6-3-5-16-4-1-2-7-20(16)18/h1-7,17,19,21H,8-15,24H2,(H,25,28).
What are the key properties of naphthalen-1-ylmethyl N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]carbamate?
naphthalen-1-ylmethyl N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]carbamate has a molecular weight of 427.57 g/mol, XLogP of 3.48, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ylmethyl N-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-3-yl)ethyl]cyclohexyl]carbamate is sourced from PubChem (CID 10296143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).