About (4-chlorophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone
(4-chlorophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 1029621) has the molecular formula C20H25ClN4O
and a molecular weight of 372.90 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | (4-chlorophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
| PubChem CID | 1029621 |
| Molecular Formula | C20H25ClN4O |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (4-chlorophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | Cc1nc(C)c(C(C)C)c(N2CCN(C(=O)c3ccc(Cl)cc3)CC2)n1 |
| InChI | InChI=1S/C20H25ClN4O/c1-13(2)18-14(3)22-15(4)23-19(18)24-9-11-25(12-10-24)20(26)16-5-7-17(21)8-6-16/h5-8,13H,9-12H2,1-4H3 |
| InChIKey | YJBMDIGCPFCAGC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-chlorophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone?
The IUPAC name of (4-chlorophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone (CID 1029621) is (4-chlorophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone.
What is the SMILES notation for (4-chlorophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone?
The canonical SMILES for (4-chlorophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone is Cc1nc(C)c(C(C)C)c(N2CCN(C(=O)c3ccc(Cl)cc3)CC2)n1.
What is the InChIKey of (4-chlorophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone?
The InChIKey is YJBMDIGCPFCAGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25ClN4O/c1-13(2)18-14(3)22-15(4)23-19(18)24-9-11-25(12-10-24)20(26)16-5-7-17(21)8-6-16/h5-8,13H,9-12H2,1-4H3.
What are the key properties of (4-chlorophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone?
(4-chlorophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone has a molecular weight of 372.90 g/mol, XLogP of 3.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone is sourced from PubChem (CID 1029621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).