C13H18BrN3O — CID 102962420
(3-bromo-4-methylpiperidin-1-yl)-(3,6-dimethylpyridazin-4-yl)methanone (PubChem CID 102962420) has the molecular formula C13H18BrN3O and a molecular weight of 312.21 g/mol. Its IUPAC name is (3-bromo-4-methylpiperidin-1-yl)-(3,6-dimethylpyridazin-4-yl)methanone.
| Compound Name | (3-bromo-4-methylpiperidin-1-yl)-(3,6-dimethylpyridazin-4-yl)methanone |
|---|---|
| PubChem CID | 102962420 |
| Molecular Formula | C13H18BrN3O |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (3-bromo-4-methylpiperidin-1-yl)-(3,6-dimethylpyridazin-4-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCC(C)C(Br)C2)c(C)nn1 |
| InChI | InChI=1S/C13H18BrN3O/c1-8-4-5-17(7-12(8)14)13(18)11-6-9(2)15-16-10(11)3/h6,8,12H,4-5,7H2,1-3H3 |
| InChIKey | SOXAKYSRRRBPNW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|