C14H22ClN3O — CID 102963119
1-(2-tert-butyl-6-chloropyrimidin-4-yl)-4-methylpiperidin-3-ol (PubChem CID 102963119) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is 1-(2-tert-butyl-6-chloropyrimidin-4-yl)-4-methylpiperidin-3-ol.
| Compound Name | 1-(2-tert-butyl-6-chloropyrimidin-4-yl)-4-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 102963119 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-(2-tert-butyl-6-chloropyrimidin-4-yl)-4-methylpiperidin-3-ol |
| SMILES | CC1CCN(c2cc(Cl)nc(C(C)(C)C)n2)CC1O |
| InChI | InChI=1S/C14H22ClN3O/c1-9-5-6-18(8-10(9)19)12-7-11(15)16-13(17-12)14(2,3)4/h7,9-10,19H,5-6,8H2,1-4H3 |
| InChIKey | CSZVNRIEMZPSAR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |