C22H18N6O2S — CID 10296327
3-benzyl-5-methoxy-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one (PubChem CID 10296327) has the molecular formula C22H18N6O2S and a molecular weight of 430.49 g/mol. Its IUPAC name is 3-benzyl-5-methoxy-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one.
| Compound Name | 3-benzyl-5-methoxy-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 10296327 |
| Molecular Formula | C22H18N6O2S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 3-benzyl-5-methoxy-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one |
| SMILES | COc1cccc2nc(CSc3ncnc4nc[nH]c34)n(Cc3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C22H18N6O2S/c1-30-16-9-5-8-15-18(16)22(29)28(10-14-6-3-2-4-7-14)17(27-15)11-31-21-19-20(24-12-23-19)25-13-26-21/h2-9,12-13H,10-11H2,1H3,(H,23,24,25,26) |
| InChIKey | BNXFTDGQFXVLIY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |