C11H16ClN3OS — CID 102963287
4-chloro-6-(3-methoxypiperidin-1-yl)-2-methylsulfanylpyrimidine (PubChem CID 102963287) has the molecular formula C11H16ClN3OS and a molecular weight of 273.79 g/mol. Its IUPAC name is 4-chloro-6-(3-methoxypiperidin-1-yl)-2-methylsulfanylpyrimidine.
| Compound Name | 4-chloro-6-(3-methoxypiperidin-1-yl)-2-methylsulfanylpyrimidine |
|---|---|
| PubChem CID | 102963287 |
| Molecular Formula | C11H16ClN3OS |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 4-chloro-6-(3-methoxypiperidin-1-yl)-2-methylsulfanylpyrimidine |
| SMILES | COC1CCCN(c2cc(Cl)nc(SC)n2)C1 |
| InChI | InChI=1S/C11H16ClN3OS/c1-16-8-4-3-5-15(7-8)10-6-9(12)13-11(14-10)17-2/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | ZMUUUDZSMIXMHJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |