C22H23ClFN3O3 — CID 10296433
1-(2-chlorophenyl)ethyl N-[5-[4-[(2-fluoroethylamino)methyl]phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate (PubChem CID 10296433) has the molecular formula C22H23ClFN3O3 and a molecular weight of 431.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl N-[5-[4-[(2-fluoroethylamino)methyl]phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate.
| Compound Name | 1-(2-chlorophenyl)ethyl N-[5-[4-[(2-fluoroethylamino)methyl]phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate |
|---|---|
| PubChem CID | 10296433 |
| Molecular Formula | C22H23ClFN3O3 |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 1-(2-chlorophenyl)ethyl N-[5-[4-[(2-fluoroethylamino)methyl]phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate |
| SMILES | Cc1noc(-c2ccc(CNCCF)cc2)c1NC(=O)OC(C)c1ccccc1Cl |
| InChI | InChI=1S/C22H23ClFN3O3/c1-14-20(26-22(28)29-15(2)18-5-3-4-6-19(18)23)21(30-27-14)17-9-7-16(8-10-17)13-25-12-11-24/h3-10,15,25H,11-13H2,1-2H3,(H,26,28) |
| InChIKey | XUIDDLBZJVEACT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|