C17H28N2O — CID 102964995
2-(3-methoxy-4-methylpiperidin-1-yl)-2-methyl-3-phenylpropan-1-amine (PubChem CID 102964995) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-(3-methoxy-4-methylpiperidin-1-yl)-2-methyl-3-phenylpropan-1-amine.
| Compound Name | 2-(3-methoxy-4-methylpiperidin-1-yl)-2-methyl-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 102964995 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 2-(3-methoxy-4-methylpiperidin-1-yl)-2-methyl-3-phenylpropan-1-amine |
| SMILES | COC1CN(C(C)(CN)Cc2ccccc2)CCC1C |
| InChI | InChI=1S/C17H28N2O/c1-14-9-10-19(12-16(14)20-3)17(2,13-18)11-15-7-5-4-6-8-15/h4-8,14,16H,9-13,18H2,1-3H3 |
| InChIKey | XWDOSJLONGCVKP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |