C15H26N2O2 — CID 102965022
2-(5-ethylfuran-2-yl)-2-(3-methoxy-4-methylpiperidin-1-yl)ethanamine (PubChem CID 102965022) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-(5-ethylfuran-2-yl)-2-(3-methoxy-4-methylpiperidin-1-yl)ethanamine.
| Compound Name | 2-(5-ethylfuran-2-yl)-2-(3-methoxy-4-methylpiperidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 102965022 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 2-(5-ethylfuran-2-yl)-2-(3-methoxy-4-methylpiperidin-1-yl)ethanamine |
| SMILES | CCc1ccc(C(CN)N2CCC(C)C(OC)C2)o1 |
| InChI | InChI=1S/C15H26N2O2/c1-4-12-5-6-14(19-12)13(9-16)17-8-7-11(2)15(10-17)18-3/h5-6,11,13,15H,4,7-10,16H2,1-3H3 |
| InChIKey | UJPDPQQTNNTBDR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |