C22H28F2N4O3 — CID 10296604
(3R)-5,5-difluoro-3-(2-methoxypyrimidin-5-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 10296604) has the molecular formula C22H28F2N4O3 and a molecular weight of 434.49 g/mol. Its IUPAC name is (3R)-5,5-difluoro-3-(2-methoxypyrimidin-5-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | (3R)-5,5-difluoro-3-(2-methoxypyrimidin-5-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 10296604 |
| Molecular Formula | C22H28F2N4O3 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (3R)-5,5-difluoro-3-(2-methoxypyrimidin-5-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | COc1ncc([C@H](CC(=O)O)CC(F)(F)CCCCc2ccc3c(n2)NCCC3)cn1 |
| InChI | InChI=1S/C22H28F2N4O3/c1-31-21-26-13-17(14-27-21)16(11-19(29)30)12-22(23,24)9-3-2-6-18-8-7-15-5-4-10-25-20(15)28-18/h7-8,13-14,16H,2-6,9-12H2,1H3,(H,25,28)(H,29,30)/t16-/m1/s1 |
| InChIKey | OXVOLBUPQVLJPD-MRXNPFEDSA-N |
| XLogP | 4.24 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|